cas: 161940-20-1 — see every product listed under this CAS number, including other names
METHYL 4-BOC-AMINOTHIOPHENE-3-CARBOXYLATE, 97% (CAS 161940-20-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F793294-1G |
| cas | 161940-20-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1096.51 Pln | |
| Fluorochem | 10g | 2132.60 Pln | |
| Fluorochem | 25g | 4360.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate (CAS 161940-20-1) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate. InChIKey: XLHBETGJNREXTR-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate |
| InChIKey | XLHBETGJNREXTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CSC=C1C(=O)OC |
Computed by PubChem (NCBI)