cas: 161940-20-1 — see every product listed under this CAS number, including other names
Methyl 4-((tert-butoxycarbonyl)amino)thiophene-3-carboxylate, 97%, 97% (CAS 161940-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SJG-100mg |
| cas | 161940-20-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 942.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate (CAS 161940-20-1) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate. InChIKey: XLHBETGJNREXTR-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate |
| InChIKey | XLHBETGJNREXTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CSC=C1C(=O)OC |
Computed by PubChem (NCBI)