cas: 1426958-40-8 — see every product listed under this CAS number, including other names
METHYL 4-FLUORO-5-HYDROXY-2-NITROBENZOATE, 97% (CAS 1426958-40-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333690-250MG |
| cas | 1426958-40-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1289.15 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 10g | 2497.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-fluoro-5-hydroxy-2-nitrobenzoate (CAS 1426958-40-8) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: methyl 4-fluoro-5-hydroxy-2-nitrobenzoate. InChIKey: IWYPVZJXNKHKRF-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | methyl 4-fluoro-5-hydroxy-2-nitrobenzoate |
| InChIKey | IWYPVZJXNKHKRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)