cas: 1426958-40-8 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-5-hydroxy-2-nitrobenzoate 98% (CAS 1426958-40-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A917308-250mg |
| cas | 1426958-40-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 3357.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A917308 |
Methyl 4-fluoro-5-hydroxy-2-nitrobenzoate (CAS 1426958-40-8) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: methyl 4-fluoro-5-hydroxy-2-nitrobenzoate. InChIKey: IWYPVZJXNKHKRF-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | methyl 4-fluoro-5-hydroxy-2-nitrobenzoate |
| InChIKey | IWYPVZJXNKHKRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)