cas: 14597-62-7 — see every product listed under this CAS number, including other names
METHYL 5-PHENYL-2-THIOPHENECARBOXYLATE, 95%, 95% (CAS 14597-62-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXGW-50mg |
| cas | 14597-62-7 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 410.00 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 1869.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-phenylthiophene-2-carboxylate (CAS 14597-62-7) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: methyl 5-phenylthiophene-2-carboxylate. InChIKey: UTTYIXTVWNXIDC-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | methyl 5-phenylthiophene-2-carboxylate |
| InChIKey | UTTYIXTVWNXIDC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(S1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)