cas: 14597-62-7 — see every product listed under this CAS number, including other names
Methyl 5-phenylthiophene-2-carboxylate, 95-<97% (CAS 14597-62-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5867-95-97-5g |
| cas | 14597-62-7 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 3912.70 Pln | |
| Hoffman Fine Chemicals | 10g | 6081.90 Pln | |
| Hoffman Fine Chemicals | 25g | 11849.42 Pln | |
| Hoffman Fine Chemicals | 50g | 18778.10 Pln | |
| Hoffman Fine Chemicals | 100g | 29860.16 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Methyl 5-phenylthiophene-2-carboxylate (CAS 14597-62-7) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: methyl 5-phenylthiophene-2-carboxylate. InChIKey: UTTYIXTVWNXIDC-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | methyl 5-phenylthiophene-2-carboxylate |
| InChIKey | UTTYIXTVWNXIDC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(S1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)