cas: 94790-24-6 — see every product listed under this CAS number, including other names
METHYL N-BOC-O-METHYL-L-TYROSINATE, 98% (CAS 94790-24-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468503-250MG |
| cas | 94790-24-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 846.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 94790-24-6) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: methyl (2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: FOMIHTTUAILLQT-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | methyl (2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | FOMIHTTUAILLQT-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)OC |
Computed by PubChem (NCBI)