Products 1895957-18-2
CAS 1895957-18-2 appears in our catalog under these names: MMPP/ 99.22% (existing batch purity), MMPP, MMPP, 99.31%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg, 1 mg.
2-methoxy-4-[(E)-3-(4-methoxyphenyl)prop-1-enyl]phenol (CAS 1895957-18-2) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 2-methoxy-4-[(E)-3-(4-methoxyphenyl)prop-1-enyl]phenol. InChIKey: YXLMKJHTTWBHRD-HWKANZROSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 2-methoxy-4-[(E)-3-(4-methoxyphenyl)prop-1-enyl]phenol |
| InChIKey | YXLMKJHTTWBHRD-HWKANZROSA-N |
| SMILES | COC1=CC=C(C=C1)C/C=C/C2=CC(=C(C=C2)O)OC |
Computed by PubChem (NCBI)