Mal-PEG4-OH, 95%
cas: 1421933-37-0 — see every product listed under this CAS number, including other names
Mal-PEG4-OH, 95% (CAS 1421933-37-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g. Offered by: Ambeed, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A464398-250mg |
| cas | 1421933-37-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1432.81 Pln | |
| Ambeed | 1g | 3140.50 Pln | |
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 500mg | 1509.20 Pln | |
| Chemat | 1g | 2147.60 Pln | |
| Chemat | 5g | 5627.60 Pln | |
| Fluorochem | 100mg | 726.85 Pln | |
| Fluorochem | 250mg | 1174.60 Pln | |
| Fluorochem | 500mg | 1945.17 Pln | |
| Fluorochem | 1g | 2929.19 Pln | |
| Fluorochem | 5g | 7635.87 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (CAS 1421933-37-0) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: 1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: DAQPEIZPEVDMSB-UHFFFAOYSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | DAQPEIZPEVDMSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCO |
Computed by PubChem (NCBI)