CAS 207120-58-9 is the registry number for Boc-d-asp(oall)-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-prop-2-enoxybutanoic acid (CAS 207120-58-9) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-prop-2-enoxybutanoic acid. InChIKey: WZMNSEVEWIDHND-MRVPVSSYSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-prop-2-enoxybutanoic acid |
| InChIKey | WZMNSEVEWIDHND-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OCC=C)C(=O)O |
Computed by PubChem (NCBI)