Products 2088462-51-3

CAS 2088462-51-3 is the registry number for 1-(tert-Butyl) 2-ethyl (2S,4R)-4-hydroxy-5-oxopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-ethyl (2S,4R)-4-hydroxy-5-oxopyrrolidine-1,2-dicarboxylate (CAS 2088462-51-3) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,4R)-4-hydroxy-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: XIMWBPGXYHVYGD-JGVFFNPUSA-N.

Identity
Molecular formulaC12H19NO6
Molecular weight273.28 g/mol
IUPAC name1-O-tert-butyl 2-O-ethyl (2S,4R)-4-hydroxy-5-oxopyrrolidine-1,2-dicarboxylate
InChIKeyXIMWBPGXYHVYGD-JGVFFNPUSA-N
SMILESCCOC(=O)[C@@H]1C[C@H](C(=O)N1C(=O)OC(C)(C)C)O

Computed by PubChem (NCBI)