Products 1421933-37-0
CAS 1421933-37-0 appears in our catalog under these names: Mal-peg3-alcohol, 95%, Mal–PEG4–OH, Mal-PEG4-OH 95%, Mal-PEG4-OH, 95%, 95%, Mal-PEG4-OH, 95.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 500mg, 100mg, 1g, 5g, 100 mg, 1 g, 250 mg.
1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione (CAS 1421933-37-0) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: 1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione. InChIKey: DAQPEIZPEVDMSB-UHFFFAOYSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| InChIKey | DAQPEIZPEVDMSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCO |
Computed by PubChem (NCBI)