CAS 1011479-76-7 appears in our catalog under these names: Azetidine-1,3,3-tricarboxylic acid 1-tert-butyl ester 3-ethyl ester, 95%, Azetidine-1,3,3-tricarboxylic acid 1-tert-Butyl ester 3-ethyl ester, 1-(tert-Butoxycarbonyl)-3-(ethoxycarbonyl)azetidine-3-carboxylic acid 95%, 1-(tert-Butoxycarbonyl)-3-(ethoxycarbonyl)azetidine-3-carboxylic acid, 95%, 95%, AZETIDINE-1,3,3-TRICARBOXYLIC ACID 1-TERT-BUTYL ESTER 3-ETHYL ESTER, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g, 500mg, 10g, 25g.
3-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 1011479-76-7) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: 3-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: RCWFRIPIIZSBEJ-UHFFFAOYSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 3-ethoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | RCWFRIPIIZSBEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)