CAS 132286-77-2 appears in our catalog under these names: Boc-asp(oall)-oh, 97%, Boc-L-Asp(OAll)-OH, Boc-Asp(OAll)-OH 97%, (S)-4-(Allyloxy)-2-((tert-butoxycarbonyl)amino)-4-oxobutanoic acid, 97%, 97%, Boc-L-aspartic acid-b-allyl ester, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-prop-2-enoxybutanoic acid (CAS 132286-77-2) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-prop-2-enoxybutanoic acid. InChIKey: WZMNSEVEWIDHND-QMMMGPOBSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-prop-2-enoxybutanoic acid |
| InChIKey | WZMNSEVEWIDHND-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCC=C)C(=O)O |
Computed by PubChem (NCBI)