Methyl (1R,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 97%
cas: 1821656-07-8 — see every product listed under this CAS number, including other names
Methyl (1R,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 97% (CAS 1821656-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A685163-100mg |
| cas | 1821656-07-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 865.44 Pln | |
| Ambeed | 250mg | 1327.12 Pln | |
| Ambeed | 1g | 3229.50 Pln | |
| Ambeed | 5g | 9554.06 Pln | |
| BLDpharm | 100mg | 925.25 Pln | |
| BLDpharm | 250mg | 1430.63 Pln | |
| BLDpharm | 1g | 3474.36 Pln | |
| BLDpharm | 5g | 10294.18 Pln | |
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 500mg | 1264.40 Pln | |
| Chemat | 1g | 1874.00 Pln | |
| Chemat | 5g | 7677.20 Pln | |
| Chemat | 10g | 13931.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 1821656-07-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: OOFXENVWECZJBF-ZJLYAJKPSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | OOFXENVWECZJBF-ZJLYAJKPSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
trans-Methyl-3-aminocyclohexanecarboxylate hydrochloride, methyl (1R,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride, trans-Methyl-3-aminocyclohexanecarboxylatehydrochloride, methyl trans-3-aminocyclohexanecarboxylate hydrochloride, Methyl (1R,3R)-3-aminocyclohexane-1-carboxylate HCl, Methyl (1R,3R)-3-Aminocyclohexanecarboxylate Hydrochloride, methyl (1R,3R)-3-aminocyclohexanecarboxylate;hydrochloride, rac-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, trans-3-Aminocyclohexanecarboxylic acid methyl ester hydrochloride, rac-methyl (1R,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, trans