CAS 30095-98-8 appears in our catalog under these names: Methyl 2-(2-nitrophenyl)acetate, 98%, 98%, Methyl 2–(2–nitrophenyl)acetate, Methyl 2-(2-nitrophenyl)acetate, 95%. Offered by: Chemat, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
Methyl 2-(2-nitrophenyl)acetate (CAS 30095-98-8) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: methyl 2-(2-nitrophenyl)acetate. InChIKey: SWMFAAPTSMVULA-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | methyl 2-(2-nitrophenyl)acetate |
| InChIKey | SWMFAAPTSMVULA-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)