cas: 936097-43-7 — see every product listed under this CAS number, including other names
Methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclopropylacetate, 97%, 97% (CAS 936097-43-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHP4-100mg |
| cas | 936097-43-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 500mg | 640.40 Pln | |
| Chemat | 1g | 928.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 936097-43-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: methyl (2R)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: DKYLCANTGPRCHY-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | methyl (2R)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | DKYLCANTGPRCHY-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1CC1)C(=O)OC |
Computed by PubChem (NCBI)