CAS 1449295-52-6 appears in our catalog under these names: methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclopropylacetate, 96%, methyl (2S)-2-{((tert-butoxy)carbonyl)amino}-2-cyclopropylacetate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 1449295-52-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: methyl (2S)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: DKYLCANTGPRCHY-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | methyl (2S)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | DKYLCANTGPRCHY-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CC1)C(=O)OC |
Computed by PubChem (NCBI)