CAS 936097-43-7 appears in our catalog under these names: methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclopropylacetate, 96%, Methyl (2R)-2-{((tert-butoxy)carbonyl)amino}-2-cyclopropylacetate, 97%, Methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclopropylacetate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 25g, 10g, 100mg, 500mg.
Methyl (2R)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 936097-43-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: methyl (2R)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: DKYLCANTGPRCHY-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | methyl (2R)-2-cyclopropyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | DKYLCANTGPRCHY-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1CC1)C(=O)OC |
Computed by PubChem (NCBI)