cas: 314741-63-4 — see every product listed under this CAS number, including other names
Methyl (S)-1-N-Cbz-piperazine-2-carboxylate, 95%, 95% (CAS 314741-63-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZR0-50mg |
| cas | 314741-63-4 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 232.40 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate (CAS 314741-63-4) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate. InChIKey: HOLPEQRNMJTIIX-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate |
| InChIKey | HOLPEQRNMJTIIX-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@@H]1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)