cas: 314741-63-4 — see every product listed under this CAS number, including other names
(S)-1-N-Cbz-piperazine-2-carboxylic acid methylester, 98% (CAS 314741-63-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041102-250MG |
| cas | 314741-63-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1346.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate (CAS 314741-63-4) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate. InChIKey: HOLPEQRNMJTIIX-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate |
| InChIKey | HOLPEQRNMJTIIX-LBPRGKRZSA-N |
| SMILES | COC(=O)[C@@H]1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)