cas: 1029689-82-4 — see every product listed under this CAS number, including other names
Methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate hydrochloride, 97% (CAS 1029689-82-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 500mg, 1g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A119022-100mg |
| cas | 1029689-82-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 538.72 Pln | |
| AmBeed | 5g | 6632.08 Pln | |
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 500mg | 841.39 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 5g | 4267.27 Pln | |
| Fluorochem | 10g | 6995.47 Pln | |
| Fluorochem | 25g | 14534.48 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate;hydrochloride (CAS 1029689-82-4) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate;hydrochloride. InChIKey: COQHHVHUWVSLQP-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate;hydrochloride |
| InChIKey | COQHHVHUWVSLQP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1CNCC2.Cl |
Computed by PubChem (NCBI)