CAS 1029689-82-4 appears in our catalog under these names: Methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate hydrochloride, 95%, Methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate hydrochloride, 97%, Methyl 1,2,3,4–tetrahydroisoquinoline–8–carboxylate hydrochloride, 8-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-, methyl ester, hydrochloride (1:1), 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 500mg, 25g.
Methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate;hydrochloride (CAS 1029689-82-4) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate;hydrochloride. InChIKey: COQHHVHUWVSLQP-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 1,2,3,4-tetrahydroisoquinoline-8-carboxylate;hydrochloride |
| InChIKey | COQHHVHUWVSLQP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1CNCC2.Cl |
Computed by PubChem (NCBI)