cas: 1090553-79-9 — see every product listed under this CAS number, including other names
Methyl 1-(4-fluorophenyl)cyclobutanecarboxylate 98% (CAS 1090553-79-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406667-250mg |
| cas | 1090553-79-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1377.19 Pln | |
| Ambeed | 25g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A406667 |
Methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate (CAS 1090553-79-9) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate. InChIKey: DKJXCIWYFJGWQR-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | methyl 1-(4-fluorophenyl)cyclobutane-1-carboxylate |
| InChIKey | DKJXCIWYFJGWQR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCC1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)