cas: 943111-83-9 — see every product listed under this CAS number, including other names
Methyl 1-(4-fluorophenyl)cyclopropanecarboxylate, 95% (CAS 943111-83-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613865-1G |
| cas | 943111-83-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 674.78 Pln | |
| Fluorochem | 10g | 1299.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate (CAS 943111-83-9) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: methyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate. InChIKey: PYHCKEAPWABESH-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | methyl 1-(4-fluorophenyl)cyclopropane-1-carboxylate |
| InChIKey | PYHCKEAPWABESH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)