cas: 400877-57-8 — see every product listed under this CAS number, including other names
Methyl 1-methyl-4-nitro-1H-pyrazole-3-carboxylate, 95% (CAS 400877-57-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F379928-1G |
| cas | 400877-57-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 383.22 Pln | |
| Fluorochem | 25g | 700.81 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 1-methyl-4-nitropyrazole-3-carboxylate (CAS 400877-57-8) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: methyl 1-methyl-4-nitropyrazole-3-carboxylate. InChIKey: KRIOGKNOYPHJPC-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | methyl 1-methyl-4-nitropyrazole-3-carboxylate |
| InChIKey | KRIOGKNOYPHJPC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)