cas: 168618-65-3 — see every product listed under this CAS number, including other names
Methyl 2'-cyano-[1,1'-biphenyl]-3-carboxylate, 97%, 97% (CAS 168618-65-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Y7W-100mg |
| cas | 168618-65-3 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 174.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(2-cyanophenyl)benzoate (CAS 168618-65-3) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: methyl 3-(2-cyanophenyl)benzoate. InChIKey: YDXNZJLIYUWQBJ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | methyl 3-(2-cyanophenyl)benzoate |
| InChIKey | YDXNZJLIYUWQBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)