cas: 5292-42-2 — see every product listed under this CAS number, including other names
Methyl 2,3,4,5-tetrafluorobenzoate, 97%, 97% (CAS 5292-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0GA-1g |
| cas | 5292-42-2 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 462.80 Pln | |
| Chemat | 100g | 1547.60 Pln | |
| Chemat | 10g | 285.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3,4,5-tetrafluorobenzoate (CAS 5292-42-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: methyl 2,3,4,5-tetrafluorobenzoate. InChIKey: MAEQYZYOSFAUAF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | methyl 2,3,4,5-tetrafluorobenzoate |
| InChIKey | MAEQYZYOSFAUAF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)