cas: 5292-42-2 — see every product listed under this CAS number, including other names
Methyl 2,3,4,5-tetrafluorobenzoate, 98% (CAS 5292-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337116-1G |
| cas | 5292-42-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 341.56 Pln | |
| Fluorochem | 25g | 591.48 Pln | |
| Fluorochem | 100g | 1846.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,3,4,5-tetrafluorobenzoate (CAS 5292-42-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: methyl 2,3,4,5-tetrafluorobenzoate. InChIKey: MAEQYZYOSFAUAF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | methyl 2,3,4,5-tetrafluorobenzoate |
| InChIKey | MAEQYZYOSFAUAF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)