Methyl 2,3-dichlorophenylacetate, 98%
cas: 10328-87-7 — see every product listed under this CAS number, including other names
Methyl 2,3-dichlorophenylacetate, 98% (CAS 10328-87-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-3687-10g |
| cas | 10328-87-7 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 100g | price on request | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 309.19 Pln | |
| Ambeed | 25g | 542.81 Pln | |
| Ambeed | 100g | 1933.44 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 400.40 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 197.73 Pln | |
| BLDpharm | 10g | 314.36 Pln | |
| BLDpharm | 25g | 514.29 Pln | |
| BLDpharm | 100g | 1774.96 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 2-(2,3-dichlorophenyl)acetate (CAS 10328-87-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2-(2,3-dichlorophenyl)acetate. InChIKey: XUMYFVFSYKMRDF-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2-(2,3-dichlorophenyl)acetate |
| InChIKey | XUMYFVFSYKMRDF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)