Products 10328-87-7
CAS 10328-87-7 appears in our catalog under these names: Methyl 2,3-dichlorophenylacetate, 98%, Methyl 2,3–Dichlorophenylacetate, Methyl 2,3-Dichlorophenylacetate 98%, Methyl 2,3-Dichlorophenylacetate, 98%, 98%, METHYL 2,3-DICHLOROPHENYLACETATE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
Methyl 2-(2,3-dichlorophenyl)acetate (CAS 10328-87-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2-(2,3-dichlorophenyl)acetate. InChIKey: XUMYFVFSYKMRDF-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2-(2,3-dichlorophenyl)acetate |
| InChIKey | XUMYFVFSYKMRDF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)