cas: 271261-71-3 — see every product listed under this CAS number, including other names
Methyl 2,4-Dihydroxy-5-Nitrobenzoate, 95%, 95% (CAS 271261-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118LSF-100mg |
| cas | 271261-71-3 |
| size | 100mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 500mg | 122.00 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 904.40 Pln | |
| Chemat | 25g | 1922.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,4-dihydroxy-5-nitrobenzoate (CAS 271261-71-3) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: methyl 2,4-dihydroxy-5-nitrobenzoate. InChIKey: RTNOQYZDKMGQGE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | methyl 2,4-dihydroxy-5-nitrobenzoate |
| InChIKey | RTNOQYZDKMGQGE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)