cas: 63112-94-7 — see every product listed under this CAS number, including other names
Methyl 2,4-bis(bromomethyl)benzoate 98% (CAS 63112-94-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1511755-10g |
| cas | 63112-94-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3418.62 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1511755 |
Methyl 2,4-bis(bromomethyl)benzoate (CAS 63112-94-7) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: methyl 2,4-bis(bromomethyl)benzoate. InChIKey: JXQSETUCFDWTNV-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | methyl 2,4-bis(bromomethyl)benzoate |
| InChIKey | JXQSETUCFDWTNV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)CBr)CBr |
Computed by PubChem (NCBI)