cas: 20577-73-5 — see every product listed under this CAS number, including other names
Methyl 2,4-dioxo-4-phenylbutanoate, 98%, 98% (CAS 20577-73-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ACL-250mg |
| cas | 20577-73-5 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 770.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,4-dioxo-4-phenylbutanoate (CAS 20577-73-5) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: methyl 2,4-dioxo-4-phenylbutanoate. InChIKey: AQYAHPDSJAFBOS-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | methyl 2,4-dioxo-4-phenylbutanoate |
| InChIKey | AQYAHPDSJAFBOS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)