cas: 394653-39-5 — see every product listed under this CAS number, including other names
Methyl 2-(((benzyloxy)carbonyl)amino)-2-(oxetan-3-ylidene)acetate, 97% (CAS 394653-39-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F325462-250MG |
| cas | 394653-39-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 500mg | 924.69 Pln | |
| Fluorochem | 1g | 1351.63 Pln | |
| Fluorochem | 5g | 3809.09 Pln | |
| Fluorochem | 10g | 6276.97 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-(oxetan-3-ylidene)-2-(phenylmethoxycarbonylamino)acetate (CAS 394653-39-5) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: methyl 2-(oxetan-3-ylidene)-2-(phenylmethoxycarbonylamino)acetate. InChIKey: NDTBYBDHYVFWSM-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | methyl 2-(oxetan-3-ylidene)-2-(phenylmethoxycarbonylamino)acetate |
| InChIKey | NDTBYBDHYVFWSM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C1COC1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)