cas: 147124-37-6 — see every product listed under this CAS number, including other names
Methyl 2-(4-chloro-2-nitrophenyl)acetate 97% (CAS 147124-37-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154375-100mg |
| cas | 147124-37-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1432.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154375 |
Methyl 2-(4-chloro-2-nitrophenyl)acetate (CAS 147124-37-6) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: methyl 2-(4-chloro-2-nitrophenyl)acetate. InChIKey: SMDKYKOCWWWBJC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | methyl 2-(4-chloro-2-nitrophenyl)acetate |
| InChIKey | SMDKYKOCWWWBJC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)