cas: 27007-53-0 — see every product listed under this CAS number, including other names
Methyl 2-Bromo-5-chlorobenzoate, 98%, 98% (CAS 27007-53-0) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1kg, 5kg, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFL0-50g |
| cas | 27007-53-0 |
| size | 50g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 155.60 Pln | |
| Chemat | 1kg | 1648.40 Pln | |
| Chemat | 5kg | 7699.20 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 242.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-5-chlorobenzoate (CAS 27007-53-0) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 2-bromo-5-chlorobenzoate. InChIKey: BIECSXCXIXHDBC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 2-bromo-5-chlorobenzoate |
| InChIKey | BIECSXCXIXHDBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)Br |
Computed by PubChem (NCBI)