cas: 27007-53-0 — see every product listed under this CAS number, including other names
Methyl 2-bromo-5-chlorobenzoate 98% (CAS 27007-53-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A232352-5g |
| cas | 27007-53-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1354.94 Pln | |
| Ambeed | 1000g | 2511.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A232352 |
Methyl 2-bromo-5-chlorobenzoate (CAS 27007-53-0) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 2-bromo-5-chlorobenzoate. InChIKey: BIECSXCXIXHDBC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 2-bromo-5-chlorobenzoate |
| InChIKey | BIECSXCXIXHDBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)Br |
Computed by PubChem (NCBI)