cas: 1805129-67-2 — see every product listed under this CAS number, including other names
Methyl 2-Chloro-5-methyl-4-nitrobenzoate, ≥95%, ≥95% (CAS 1805129-67-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMC9-100mg |
| cas | 1805129-67-2 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2848.40 Pln | |
| Chemat | 10g | 4691.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-chloro-5-methyl-4-nitrobenzoate (CAS 1805129-67-2) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: methyl 2-chloro-5-methyl-4-nitrobenzoate. InChIKey: KXABNFJJVGOGHI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | methyl 2-chloro-5-methyl-4-nitrobenzoate |
| InChIKey | KXABNFJJVGOGHI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])Cl)C(=O)OC |
Computed by PubChem (NCBI)