cas: 6307-82-0 — see every product listed under this CAS number, including other names
Methyl 2-Chloro-5-nitrobenzoate, >98.0%(GC) (CAS 6307-82-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1732-5G |
| cas | 6307-82-0 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 113.43 Pln | |
| TCI | 25g | 334.70 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Methyl 2-chloro-5-nitrobenzoate (CAS 6307-82-0) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: methyl 2-chloro-5-nitrobenzoate. InChIKey: VCYWZLGOWNCJNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | methyl 2-chloro-5-nitrobenzoate |
| InChIKey | VCYWZLGOWNCJNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)