cas: 6307-82-0 — see every product listed under this CAS number, including other names
Methyl 2–Chloro–5–nitrobenzoate (CAS 6307-82-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 25g, 50g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD16585-100g |
| cas | 6307-82-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1687.60 Pln | |
| GLPBio | 250g | 2871.76 Pln | |
| GLPBio | 25g | 849.79 Pln | |
| GLPBio | 50g | 1135.30 Pln | |
| GLPBio | 5g | 536.19 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-chloro-5-nitrobenzoate (CAS 6307-82-0) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: methyl 2-chloro-5-nitrobenzoate. InChIKey: VCYWZLGOWNCJNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | methyl 2-chloro-5-nitrobenzoate |
| InChIKey | VCYWZLGOWNCJNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)