Methyl 2-amino-2-(pyridin-2-yl)acetate hydrochloride, 95%
cas: 1354949-64-6 — see every product listed under this CAS number, including other names
Methyl 2-amino-2-(pyridin-2-yl)acetate hydrochloride, 95% (CAS 1354949-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A496877-100mg |
| cas | 1354949-64-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 726.80 Pln | |
| Chemat | 1g | 2046.80 Pln | |
| Fluorochem | 250mg | 1341.21 Pln | |
| Fluorochem | 1g | 3777.85 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1591.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-amino-2-pyridin-2-ylacetate;hydrochloride (CAS 1354949-64-6) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: methyl 2-amino-2-pyridin-2-ylacetate;hydrochloride. InChIKey: PCPOXRZFRXSGDS-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | methyl 2-amino-2-pyridin-2-ylacetate;hydrochloride |
| InChIKey | PCPOXRZFRXSGDS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=N1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl 2-amino-2-(pyridin-2-yl)acetate hydrochloride, methyl 2-amino-2-pyridin-2-ylacetate;hydrochloride, methyl 2-amino-2-(2-pyridyl)acetate hydrochloride, Methyl2-amino-2-(pyridin-2-yl)acetatehydrochloride, methyl 2-amino-2-(2-pyridyl)acetate;hydrochloride, Methyl amino(pyridin-2-yl)acetate--hydrogen chloride (1/1)