cas: 68697-61-0 — see every product listed under this CAS number, including other names
Methyl 2-amino-3-(4-hydroxyphenyl)propanoate hydrochloride, 97% (CAS 68697-61-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241935-25G |
| cas | 68697-61-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 258.26 Pln | |
| Fluorochem | 500g | 1075.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 68697-61-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: VXYFARNRGZWHTJ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | VXYFARNRGZWHTJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)