cas: 5202-89-1 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-chlorobenzoate, 95% (CAS 5202-89-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 426160010 |
| cas | 5202-89-1 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 314.04 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Methyl 2-amino-5-chlorobenzoate (CAS 5202-89-1) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: methyl 2-amino-5-chlorobenzoate. InChIKey: IGHVUURTQGBABT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | methyl 2-amino-5-chlorobenzoate |
| InChIKey | IGHVUURTQGBABT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)N |
Computed by PubChem (NCBI)