cas: 5202-89-1 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-chlorobenzoate, 98%, 98% (CAS 5202-89-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114691-1g |
| cas | 5202-89-1 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 98.00 Pln | |
| Chemat | 250g | 150.80 Pln | |
| Chemat | 500g | 307.20 Pln | |
| Chemat | 1kg | 530.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-5-chlorobenzoate (CAS 5202-89-1) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: methyl 2-amino-5-chlorobenzoate. InChIKey: IGHVUURTQGBABT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | methyl 2-amino-5-chlorobenzoate |
| InChIKey | IGHVUURTQGBABT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)N |
Computed by PubChem (NCBI)