Methyl 2-bromo-3,5-dichloroisonicotinate, 97%
cas: 1807028-93-8 — see every product listed under this CAS number, including other names
Methyl 2-bromo-3,5-dichloroisonicotinate, 97% (CAS 1807028-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F865134-100MG |
| cas | 1807028-93-8 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 1325.59 Pln | |
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 914.00 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Methyl 2-bromo-3,5-dichloropyridine-4-carboxylate (CAS 1807028-93-8) is a chemical compound with the molecular formula C7H4BrCl2NO2 and a molecular weight of 284.92 g/mol. IUPAC name: methyl 2-bromo-3,5-dichloropyridine-4-carboxylate. InChIKey: SIYYDKQQURVQJQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO2 |
|---|---|
| Molecular weight | 284.92 g/mol |
| IUPAC name | methyl 2-bromo-3,5-dichloropyridine-4-carboxylate |
| InChIKey | SIYYDKQQURVQJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1Cl)Br)Cl |
Computed by PubChem (NCBI)