Products 1823373-59-6
CAS 1823373-59-6 appears in our catalog under these names: Methyl 5-bromo-2,6-dichloronicotinate, 98%, 98%, Methyl 5-bromo-2,6-dichloronicotinate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-bromo-2,6-dichloropyridine-3-carboxylate (CAS 1823373-59-6) is a chemical compound with the molecular formula C7H4BrCl2NO2 and a molecular weight of 284.92 g/mol. IUPAC name: methyl 5-bromo-2,6-dichloropyridine-3-carboxylate. InChIKey: NMWIKOMGZJLEPD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO2 |
|---|---|
| Molecular weight | 284.92 g/mol |
| IUPAC name | methyl 5-bromo-2,6-dichloropyridine-3-carboxylate |
| InChIKey | NMWIKOMGZJLEPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1Cl)Cl)Br |
Computed by PubChem (NCBI)