CAS 1415124-69-4 appears in our catalog under these names: 3–Amino–4–bromo–2,6–dichlorobenzoic acid, 3-Amino-4-bromo-2,6-dichlorobenzoic acid, 95%, 3-Amino-4-bromo-2,6-dichlorobenzoic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg.
3-amino-4-bromo-2,6-dichlorobenzoic acid (CAS 1415124-69-4) is a chemical compound with the molecular formula C7H4BrCl2NO2 and a molecular weight of 284.92 g/mol. IUPAC name: 3-amino-4-bromo-2,6-dichlorobenzoic acid. InChIKey: FHPFUBUFUCGMAY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO2 |
|---|---|
| Molecular weight | 284.92 g/mol |
| IUPAC name | 3-amino-4-bromo-2,6-dichlorobenzoic acid |
| InChIKey | FHPFUBUFUCGMAY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)N)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)