CAS 1258546-74-5 appears in our catalog under these names: 1-(Bromomethyl)-3,5-dichloro-2-nitrobenzene, 95%, 1-(Bromomethyl)-3,5-dichloro-2-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(bromomethyl)-3,5-dichloro-2-nitrobenzene (CAS 1258546-74-5) is a chemical compound with the molecular formula C7H4BrCl2NO2 and a molecular weight of 284.92 g/mol. IUPAC name: 1-(bromomethyl)-3,5-dichloro-2-nitrobenzene. InChIKey: DLCJCQAFRQOIIA-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO2 |
|---|---|
| Molecular weight | 284.92 g/mol |
| IUPAC name | 1-(bromomethyl)-3,5-dichloro-2-nitrobenzene |
| InChIKey | DLCJCQAFRQOIIA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CBr)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)