Products 1807028-93-8
CAS 1807028-93-8 appears in our catalog under these names: Methyl 2-bromo-3,5-dichloroisonicotinate, 97%, 97%, Methyl 2-bromo-3,5-dichloroisonicotinate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-bromo-3,5-dichloropyridine-4-carboxylate (CAS 1807028-93-8) is a chemical compound with the molecular formula C7H4BrCl2NO2 and a molecular weight of 284.92 g/mol. IUPAC name: methyl 2-bromo-3,5-dichloropyridine-4-carboxylate. InChIKey: SIYYDKQQURVQJQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO2 |
|---|---|
| Molecular weight | 284.92 g/mol |
| IUPAC name | methyl 2-bromo-3,5-dichloropyridine-4-carboxylate |
| InChIKey | SIYYDKQQURVQJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1Cl)Br)Cl |
Computed by PubChem (NCBI)